CAS 205692-61-1 appears in our catalog under these names: 2-(5-Methoxy-2-nitrophenyl)malondialdehyde monohydrate, 95%, 2-(5-Methoxy-2-nitrophenyl)malonaldehyde hydrate, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g.
2-(5-methoxy-2-nitrophenyl)propanedial;hydrate (CAS 205692-61-1) is a chemical compound with the molecular formula C10H11NO6 and a molecular weight of 241.20 g/mol. IUPAC name: 2-(5-methoxy-2-nitrophenyl)propanedial;hydrate. InChIKey: SKQBOFQBGCIELP-UHFFFAOYSA-N.
| Molecular formula | C10H11NO6 |
|---|---|
| Molecular weight | 241.20 g/mol |
| IUPAC name | 2-(5-methoxy-2-nitrophenyl)propanedial;hydrate |
| InChIKey | SKQBOFQBGCIELP-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)[N+](=O)[O-])C(C=O)C=O.O |
Computed by PubChem (NCBI)