Products 78361-13-4

CAS 78361-13-4 is the registry number for 5-(2-Methoxyethoxy)-2-nitrobenzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.

Structural formula: {0} (CAS {1})

5-(2-methoxyethoxy)-2-nitrobenzoic acid (CAS 78361-13-4) is a chemical compound with the molecular formula C10H11NO6 and a molecular weight of 241.20 g/mol. IUPAC name: 5-(2-methoxyethoxy)-2-nitrobenzoic acid. InChIKey: KIIRJRFGMLKNOI-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11NO6
Molecular weight241.20 g/mol
IUPAC name5-(2-methoxyethoxy)-2-nitrobenzoic acid
InChIKeyKIIRJRFGMLKNOI-UHFFFAOYSA-N
SMILESCOCCOC1=CC(=C(C=C1)[N+](=O)[O-])C(=O)O

Computed by PubChem (NCBI)