CAS 78361-13-4 is the registry number for 5-(2-Methoxyethoxy)-2-nitrobenzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
5-(2-methoxyethoxy)-2-nitrobenzoic acid (CAS 78361-13-4) is a chemical compound with the molecular formula C10H11NO6 and a molecular weight of 241.20 g/mol. IUPAC name: 5-(2-methoxyethoxy)-2-nitrobenzoic acid. InChIKey: KIIRJRFGMLKNOI-UHFFFAOYSA-N.
| Molecular formula | C10H11NO6 |
|---|---|
| Molecular weight | 241.20 g/mol |
| IUPAC name | 5-(2-methoxyethoxy)-2-nitrobenzoic acid |
| InChIKey | KIIRJRFGMLKNOI-UHFFFAOYSA-N |
| SMILES | COCCOC1=CC(=C(C=C1)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)