cas: 1072811-86-9 — see every product listed under this CAS number, including other names
2-(7-Methoxybenzofuran-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97% (CAS 1072811-86-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A515204-5g |
| cas | 1072811-86-9 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 29267.35 Pln | |
| AmBeed | 1g | 10140.97 Pln | |
| AmBeed | 10g | 43400.56 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(7-methoxy-1-benzofuran-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1072811-86-9) is a chemical compound with the molecular formula C15H19BO4 and a molecular weight of 274.12 g/mol. IUPAC name: 2-(7-methoxy-1-benzofuran-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: QRDKVKFLDQQDFZ-UHFFFAOYSA-N.
| Molecular formula | C15H19BO4 |
|---|---|
| Molecular weight | 274.12 g/mol |
| IUPAC name | 2-(7-methoxy-1-benzofuran-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | QRDKVKFLDQQDFZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(O2)C(=CC=C3)OC |
Computed by PubChem (NCBI)