CAS 1967825-39-3 is the registry number for (2E)-3-[3-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
(E)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enoic acid (CAS 1967825-39-3) is a chemical compound with the molecular formula C15H19BO4 and a molecular weight of 274.12 g/mol. IUPAC name: (E)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enoic acid. InChIKey: DVZDHXLKCCHHTD-CMDGGOBGSA-N.
| Molecular formula | C15H19BO4 |
|---|---|
| Molecular weight | 274.12 g/mol |
| IUPAC name | (E)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enoic acid |
| InChIKey | DVZDHXLKCCHHTD-CMDGGOBGSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)/C=C/C(=O)O |
Computed by PubChem (NCBI)