Products 1400077-05-5
CAS 1400077-05-5 is the registry number for (5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzofuran-2-yl)methanol, 97%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-2-yl]methanol (CAS 1400077-05-5) is a chemical compound with the molecular formula C15H19BO4 and a molecular weight of 274.12 g/mol. IUPAC name: [5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-2-yl]methanol. InChIKey: SDBNJHIGJKYSSL-UHFFFAOYSA-N.
| Molecular formula | C15H19BO4 |
|---|---|
| Molecular weight | 274.12 g/mol |
| IUPAC name | [5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-2-yl]methanol |
| InChIKey | SDBNJHIGJKYSSL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)OC(=C3)CO |
Computed by PubChem (NCBI)