CAS 1072944-97-8 appears in our catalog under these names: 4-(E-2-Carboxyvinyl)phenylboronic acid pinacol ester, 98%, 4–(E–2–Carboxyvinyl)phenylboronic acid pinacol ester, (E)-4-(2-Carboxyvinyl)phenylboronic Acid Pinacol Ester 98%, (E)-3-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acrylic acid, 98%, 98%, (E)-3-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acrylic acid, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 100mg.
(E)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enoic acid (CAS 1072944-97-8) is a chemical compound with the molecular formula C15H19BO4 and a molecular weight of 274.12 g/mol. IUPAC name: (E)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enoic acid. InChIKey: LNNZFLJPNKVNCC-JXMROGBWSA-N.
| Molecular formula | C15H19BO4 |
|---|---|
| Molecular weight | 274.12 g/mol |
| IUPAC name | (E)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enoic acid |
| InChIKey | LNNZFLJPNKVNCC-JXMROGBWSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)/C=C/C(=O)O |
Computed by PubChem (NCBI)