CAS 2484920-14-9 appears in our catalog under these names: 2-Oxochroman-6-ylboronic acid, pinacol ester, 95%, 6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)chroman-2-one 95%, 6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)chroman-2-one, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydrochromen-2-one (CAS 2484920-14-9) is a chemical compound with the molecular formula C15H19BO4 and a molecular weight of 274.12 g/mol. IUPAC name: 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydrochromen-2-one. InChIKey: RGTGWPZRWOIMTE-UHFFFAOYSA-N.
| Molecular formula | C15H19BO4 |
|---|---|
| Molecular weight | 274.12 g/mol |
| IUPAC name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydrochromen-2-one |
| InChIKey | RGTGWPZRWOIMTE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)OC(=O)CC3 |
Computed by PubChem (NCBI)