cas: 2006277-69-4 — see every product listed under this CAS number, including other names
2-(8H-Indeno[1,2-c]thiophen-8-yl)ethanol, ≥95%, ≥95% (CAS 2006277-69-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IM0B-1g |
| cas | 2006277-69-4 |
| size | 1g |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1192.40 Pln | |
| Chemat | 5g | 4466.00 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
2-(4H-indeno[2,3-c]thiophen-4-yl)ethanol (CAS 2006277-69-4) is a chemical compound with the molecular formula C13H12OS and a molecular weight of 216.30 g/mol. IUPAC name: 2-(4H-indeno[2,3-c]thiophen-4-yl)ethanol. InChIKey: MZUKZVGCSFZCNX-UHFFFAOYSA-N.
| Molecular formula | C13H12OS |
|---|---|
| Molecular weight | 216.30 g/mol |
| IUPAC name | 2-(4H-indeno[2,3-c]thiophen-4-yl)ethanol |
| InChIKey | MZUKZVGCSFZCNX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CSC=C23)CCO |
Computed by PubChem (NCBI)