cas: 524-80-1 — see every product listed under this CAS number, including other names
2-(9H-Carbazol-9-yl)acetic acid, 95%, 95% (CAS 524-80-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D0BW-100mg |
| cas | 524-80-1 |
| size | 100mg |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 218.00 Pln | |
| Chemat | 250mg | 328.40 Pln | |
| Chemat | 1g | 722.00 Pln | |
| Chemat | 5g | 2387.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-carbazol-9-ylacetic acid (CAS 524-80-1) is a chemical compound with the molecular formula C14H11NO2 and a molecular weight of 225.24 g/mol. IUPAC name: 2-carbazol-9-ylacetic acid. InChIKey: PBDMLLFEZXXJNE-UHFFFAOYSA-N.
| Molecular formula | C14H11NO2 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | 2-carbazol-9-ylacetic acid |
| InChIKey | PBDMLLFEZXXJNE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3N2CC(=O)O |
Computed by PubChem (NCBI)