CAS 5813-90-1 appears in our catalog under these names: Xanthene-9-carboxamide, 98%, Xanthene-9-carboxamide, >95% (HPLC). Offered by: Combi-blocks, TRC. Available pack sizes: 1g, 25g, 5g, 100mg, 500mg, 50mg.
9H-xanthene-9-carboxamide (CAS 5813-90-1) is a chemical compound with the molecular formula C14H11NO2 and a molecular weight of 225.24 g/mol. IUPAC name: 9H-xanthene-9-carboxamide. InChIKey: WEDLKOCAEPRSPJ-UHFFFAOYSA-N.
| Molecular formula | C14H11NO2 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | 9H-xanthene-9-carboxamide |
| InChIKey | WEDLKOCAEPRSPJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C3O2)C(=O)N |
Computed by PubChem (NCBI)