Products 2896-23-3
CAS 2896-23-3 appears in our catalog under these names: 2-Ethyl-1h-benzo[de]isoquinoline-1,3(2h)-dione, 95%, 2-Ethyl-1H-benzo(De)isoquinoline-1,3(2H)-dione, 2-Ethyl-1H-benzo(de)isoquinoline-1,3(2H)-dione, 95+%, 2–Ethyl–1H–benzo(de)isoquinoline–1，3(2H)–dione, N-Ethyl-1,8-naphthalimide, 95%, 95%. Offered by: Combi-blocks, TRC, AmBeed, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 5g, 500mg, 100mg.
2-ethylbenzo[de]isoquinoline-1,3-dione (CAS 2896-23-3) is a chemical compound with the molecular formula C14H11NO2 and a molecular weight of 225.24 g/mol. IUPAC name: 2-ethylbenzo[de]isoquinoline-1,3-dione. InChIKey: YATFILGBMGSWTE-UHFFFAOYSA-N.
| Molecular formula | C14H11NO2 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | 2-ethylbenzo[de]isoquinoline-1,3-dione |
| InChIKey | YATFILGBMGSWTE-UHFFFAOYSA-N |
| SMILES | CCN1C(=O)C2=CC=CC3=C2C(=CC=C3)C1=O |
Computed by PubChem (NCBI)