CAS 1129278-73-4 appears in our catalog under these names: 4-Phenyl-3,4-dihydro-2h-benzo[e][1,3]oxazin-2-one, 95%, 4-Phenyl-3,4-dihydro-2H-benzo(e)(1,3)oxazin-2-one, 97%, 4–Phenyl–3,4–dihydro–2H–benzo(e)(1,3)oxazin–2–one. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 100mg, 250mg, 1g.
4-phenyl-3,4-dihydro-1,3-benzoxazin-2-one (CAS 1129278-73-4) is a chemical compound with the molecular formula C14H11NO2 and a molecular weight of 225.24 g/mol. IUPAC name: 4-phenyl-3,4-dihydro-1,3-benzoxazin-2-one. InChIKey: MFDUOPFNWJRTBJ-UHFFFAOYSA-N.
| Molecular formula | C14H11NO2 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | 4-phenyl-3,4-dihydro-1,3-benzoxazin-2-one |
| InChIKey | MFDUOPFNWJRTBJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2C3=CC=CC=C3OC(=O)N2 |
Computed by PubChem (NCBI)