CAS 4003-94-5 is the registry number for 4-Nitrostilbene, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
(E)-4-nitrostilbene is a stilbenoid with a structure of (E)-stilbene substituted at one of the C-4 positions by a nitro group. It has a role as a mutagen.
Source: ChEBI
| Molecular formula | C14H11NO2 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | 1-nitro-4-[(E)-2-phenylethenyl]benzene |
| InChIKey | ZISCOWXWCHUSMH-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)