cas: 1429027-74-6 — see every product listed under this CAS number, including other names
2-(Benzyloxy)-1-bromo-4-(trifluoromethyl)benzene, 97%, 97% (CAS 1429027-74-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch132QAV-250mg |
| cas | 1429027-74-6 |
| size | 250mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 309.20 Pln | |
| Chemat | 1g | 702.80 Pln | |
| Chemat | 5g | 2378.00 Pln | |
| Chemat | 10g | 4000.40 Pln | |
| Chemat | 25g | 7936.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-bromo-2-phenylmethoxy-4-(trifluoromethyl)benzene (CAS 1429027-74-6) is a chemical compound with the molecular formula C14H10BrF3O and a molecular weight of 331.13 g/mol. IUPAC name: 1-bromo-2-phenylmethoxy-4-(trifluoromethyl)benzene. InChIKey: QBAAYEIWQPAGAY-UHFFFAOYSA-N.
| Molecular formula | C14H10BrF3O |
|---|---|
| Molecular weight | 331.13 g/mol |
| IUPAC name | 1-bromo-2-phenylmethoxy-4-(trifluoromethyl)benzene |
| InChIKey | QBAAYEIWQPAGAY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=CC(=C2)C(F)(F)F)Br |
Computed by PubChem (NCBI)