cas: 1429027-74-6 — see every product listed under this CAS number, including other names
3-Benzyloxy-4-bromobenzotrifluoride, 97% (CAS 1429027-74-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F631859-250MG |
| cas | 1429027-74-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 482.14 Pln | |
| Fluorochem | 1g | 1138.16 Pln | |
| Fluorochem | 5g | 3913.22 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-bromo-2-phenylmethoxy-4-(trifluoromethyl)benzene (CAS 1429027-74-6) is a chemical compound with the molecular formula C14H10BrF3O and a molecular weight of 331.13 g/mol. IUPAC name: 1-bromo-2-phenylmethoxy-4-(trifluoromethyl)benzene. InChIKey: QBAAYEIWQPAGAY-UHFFFAOYSA-N.
| Molecular formula | C14H10BrF3O |
|---|---|
| Molecular weight | 331.13 g/mol |
| IUPAC name | 1-bromo-2-phenylmethoxy-4-(trifluoromethyl)benzene |
| InChIKey | QBAAYEIWQPAGAY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=CC(=C2)C(F)(F)F)Br |
Computed by PubChem (NCBI)