cas: 153240-85-8 — see every product listed under this CAS number, including other names
2-(Benzyloxy)-4-bromophenol 95% (CAS 153240-85-8) is a chemical reagent available from Chemat. Available pack sizes: 500g, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A205566-500g |
| cas | 153240-85-8 |
| size | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 10377.31 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 298.06 Pln | |
| Ambeed | 10g | 431.56 Pln | |
| Ambeed | 25g | 921.06 Pln | |
| Ambeed | 100g | 2645.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A205566 |
4-bromo-2-phenylmethoxyphenol (CAS 153240-85-8) is a chemical compound with the molecular formula C13H11BrO2 and a molecular weight of 279.13 g/mol. IUPAC name: 4-bromo-2-phenylmethoxyphenol. InChIKey: FCRCHBBRZJZSHO-UHFFFAOYSA-N.
| Molecular formula | C13H11BrO2 |
|---|---|
| Molecular weight | 279.13 g/mol |
| IUPAC name | 4-bromo-2-phenylmethoxyphenol |
| InChIKey | FCRCHBBRZJZSHO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=CC(=C2)Br)O |
Computed by PubChem (NCBI)