CAS 1354035-48-5 is the registry number for Methyl 4-bromo-1-methyl-2-naphthoate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
Methyl 4-bromo-1-methylnaphthalene-2-carboxylate (CAS 1354035-48-5) is a chemical compound with the molecular formula C13H11BrO2 and a molecular weight of 279.13 g/mol. IUPAC name: methyl 4-bromo-1-methylnaphthalene-2-carboxylate. InChIKey: HPSGYXGKKXPZNY-UHFFFAOYSA-N.
| Molecular formula | C13H11BrO2 |
|---|---|
| Molecular weight | 279.13 g/mol |
| IUPAC name | methyl 4-bromo-1-methylnaphthalene-2-carboxylate |
| InChIKey | HPSGYXGKKXPZNY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C2=CC=CC=C12)Br)C(=O)OC |
Computed by PubChem (NCBI)