Products 91271-31-7

CAS 91271-31-7 is the registry number for Ethyl 5-bromo-1-naphthoate, 96%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 5-bromonaphthalene-1-carboxylate (CAS 91271-31-7) is a chemical compound with the molecular formula C13H11BrO2 and a molecular weight of 279.13 g/mol. IUPAC name: ethyl 5-bromonaphthalene-1-carboxylate. InChIKey: YEHJJJISRDQDER-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11BrO2
Molecular weight279.13 g/mol
IUPAC nameethyl 5-bromonaphthalene-1-carboxylate
InChIKeyYEHJJJISRDQDER-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC=CC2=C1C=CC=C2Br

Computed by PubChem (NCBI)