Products 194204-29-0
CAS 194204-29-0 appears in our catalog under these names: 2-Methoxy-4-phenoxybromobenzene, 95%, 2-Methoxy-4-phenoxybromobenzene. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
1-bromo-2-methoxy-4-phenoxybenzene (CAS 194204-29-0) is a chemical compound with the molecular formula C13H11BrO2 and a molecular weight of 279.13 g/mol. IUPAC name: 1-bromo-2-methoxy-4-phenoxybenzene. InChIKey: ZCGCUTBUFVBZMO-UHFFFAOYSA-N.
| Molecular formula | C13H11BrO2 |
|---|---|
| Molecular weight | 279.13 g/mol |
| IUPAC name | 1-bromo-2-methoxy-4-phenoxybenzene |
| InChIKey | ZCGCUTBUFVBZMO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)OC2=CC=CC=C2)Br |
Computed by PubChem (NCBI)