CAS 773134-84-2 appears in our catalog under these names: Ethyl 1-bromo-2-naphthoate, 98%, Ethyl 1-bromo-2-naphthoate 98%, Ethyl 1-bromo-2-naphthoate, 97%, Ethyl 1-bromo-2-naphthoate, 98%, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 5g, 10g, 1g, 25g, 100g.
Ethyl 1-bromonaphthalene-2-carboxylate (CAS 773134-84-2) is a chemical compound with the molecular formula C13H11BrO2 and a molecular weight of 279.13 g/mol. IUPAC name: ethyl 1-bromonaphthalene-2-carboxylate. InChIKey: TXDQMAGPAKABJU-UHFFFAOYSA-N.
| Molecular formula | C13H11BrO2 |
|---|---|
| Molecular weight | 279.13 g/mol |
| IUPAC name | ethyl 1-bromonaphthalene-2-carboxylate |
| InChIKey | TXDQMAGPAKABJU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=CC=CC=C2C=C1)Br |
Computed by PubChem (NCBI)