cas: 127337-60-4 — see every product listed under this CAS number, including other names
2-(Chloromethyl)-3-methyl-4-(2,2,2-trifluoroethoxy)pyridine Hydrochloride, >98.0%(HPLC)(T) (CAS 127337-60-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | C2532-5G |
| cas | 127337-60-4 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 98.68 Pln | |
| TCI | 25g | 241.28 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
2-(chloromethyl)-3-methyl-4-(2,2,2-trifluoroethoxy)pyridine;hydrochloride (CAS 127337-60-4) is a chemical compound with the molecular formula C9H10Cl2F3NO and a molecular weight of 276.08 g/mol. IUPAC name: 2-(chloromethyl)-3-methyl-4-(2,2,2-trifluoroethoxy)pyridine;hydrochloride. InChIKey: CMZBQUWICURDCD-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2F3NO |
|---|---|
| Molecular weight | 276.08 g/mol |
| IUPAC name | 2-(chloromethyl)-3-methyl-4-(2,2,2-trifluoroethoxy)pyridine;hydrochloride |
| InChIKey | CMZBQUWICURDCD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CN=C1CCl)OCC(F)(F)F.Cl |
Computed by PubChem (NCBI)