cas: 127337-60-4 — see every product listed under this CAS number, including other names
2-Chloromethyl-3-methyl-4-(2,2,2-trifluoro-ethoxy)-pyridine hydrochloride, 96% (CAS 127337-60-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F049161-25G |
| cas | 127337-60-4 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 81.24 Pln | |
| Fluorochem | 100g | 133.30 Pln | |
| Fluorochem | 500g | 450.90 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
2-(chloromethyl)-3-methyl-4-(2,2,2-trifluoroethoxy)pyridine;hydrochloride (CAS 127337-60-4) is a chemical compound with the molecular formula C9H10Cl2F3NO and a molecular weight of 276.08 g/mol. IUPAC name: 2-(chloromethyl)-3-methyl-4-(2,2,2-trifluoroethoxy)pyridine;hydrochloride. InChIKey: CMZBQUWICURDCD-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2F3NO |
|---|---|
| Molecular weight | 276.08 g/mol |
| IUPAC name | 2-(chloromethyl)-3-methyl-4-(2,2,2-trifluoroethoxy)pyridine;hydrochloride |
| InChIKey | CMZBQUWICURDCD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CN=C1CCl)OCC(F)(F)F.Cl |
Computed by PubChem (NCBI)