cas: 127337-60-4 — see every product listed under this CAS number, including other names
2-Chloromethyl-3-methyl-4-(2,2,2-trifluoroethoxy)pyridine hydrochloride, 97%, 97% (CAS 127337-60-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g, 100g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111WWY-1g |
| cas | 127337-60-4 |
| size | 1g |
| availability | 2000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 10g | 74.00 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 100g | 117.20 Pln | |
| Chemat | 1kg | 731.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(chloromethyl)-3-methyl-4-(2,2,2-trifluoroethoxy)pyridine;hydrochloride (CAS 127337-60-4) is a chemical compound with the molecular formula C9H10Cl2F3NO and a molecular weight of 276.08 g/mol. IUPAC name: 2-(chloromethyl)-3-methyl-4-(2,2,2-trifluoroethoxy)pyridine;hydrochloride. InChIKey: CMZBQUWICURDCD-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2F3NO |
|---|---|
| Molecular weight | 276.08 g/mol |
| IUPAC name | 2-(chloromethyl)-3-methyl-4-(2,2,2-trifluoroethoxy)pyridine;hydrochloride |
| InChIKey | CMZBQUWICURDCD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CN=C1CCl)OCC(F)(F)F.Cl |
Computed by PubChem (NCBI)