CAS 33575-83-6 appears in our catalog under these names: 2-(Chloromethyl)-5-phenyl-1,3,4-oxadiazole, 95-<97%, 2–(Chloromethyl)–5–phenyl–1,3,4–oxadiazole, 2-(Chloromethyl)-5-phenyl-1,3,4-oxadiazole, 97%. Offered by: Hoffman Fine Chemicals, GLPBio, Thermo Scientific (Acros), Fluorochem. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g, 100mg, 1g.
2-(chloromethyl)-5-phenyl-1,3,4-oxadiazole (CAS 33575-83-6) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. IUPAC name: 2-(chloromethyl)-5-phenyl-1,3,4-oxadiazole. InChIKey: AGLNTFQAHIRTFA-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 2-(chloromethyl)-5-phenyl-1,3,4-oxadiazole |
| InChIKey | AGLNTFQAHIRTFA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(O2)CCl |
Computed by PubChem (NCBI)