Products 22815-98-1
CAS 22815-98-1 appears in our catalog under these names: 2-(4-chlorophenyl)-5-methyl-1,3,4-oxadiazole, 98%, 98%, 2-(4-Chlorophenyl)-5-methyl-1,3,4-oxadiazole, 95%, 2-(4-Chlorophenyl)-5-methyl-1,3,4-oxadiazole 98%, 2-(4-Chlorophenyl)-5-methyl-1,3,4-oxadiazole, 98%. Offered by: Chemat, Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2-(4-chlorophenyl)-5-methyl-1,3,4-oxadiazole (CAS 22815-98-1) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. IUPAC name: 2-(4-chlorophenyl)-5-methyl-1,3,4-oxadiazole. InChIKey: IWHCZNKJMUMKTL-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-5-methyl-1,3,4-oxadiazole |
| InChIKey | IWHCZNKJMUMKTL-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(O1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)