CAS 21614-47-1 is the registry number for 3-(4-Chlorophenyl)-5-methyl-1,2,4-oxadiazole, 96%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 100g, 1g.
3-(4-chlorophenyl)-5-methyl-1,2,4-oxadiazole (CAS 21614-47-1) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. IUPAC name: 3-(4-chlorophenyl)-5-methyl-1,2,4-oxadiazole. InChIKey: XLPRFGPYWXKAHH-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-5-methyl-1,2,4-oxadiazole |
| InChIKey | XLPRFGPYWXKAHH-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NO1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)