Products 1201-68-9
CAS 1201-68-9 appears in our catalog under these names: 3-(Chloromethyl)-5-phenyl-1,2,4-oxadiazole, 95%, 3-(Chloromethyl)-5-phenyl-1,2,4-oxadiazole, 97% , 3-(Chloromethyl)-5-phenyl-1,2,4-oxadiazole 95%, 3-(Chloromethyl)-5-phenyl-1,2,4-oxadiazole, 95%, 95%. Offered by: Combi-blocks, Thermo Scientific, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
3-(chloromethyl)-5-phenyl-1,2,4-oxadiazole (CAS 1201-68-9) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. IUPAC name: 3-(chloromethyl)-5-phenyl-1,2,4-oxadiazole. InChIKey: VEIXFEJMHJPUBS-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 3-(chloromethyl)-5-phenyl-1,2,4-oxadiazole |
| InChIKey | VEIXFEJMHJPUBS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NO2)CCl |
Computed by PubChem (NCBI)