CAS 69099-05-4 is the registry number for 7-Chloro-1-methyl-1,8-naphthyridin-2(1h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
7-chloro-1-methyl-1,8-naphthyridin-2-one (CAS 69099-05-4) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. IUPAC name: 7-chloro-1-methyl-1,8-naphthyridin-2-one. InChIKey: UVTVRFOUXPZFJL-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 7-chloro-1-methyl-1,8-naphthyridin-2-one |
| InChIKey | UVTVRFOUXPZFJL-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C=CC2=C1N=C(C=C2)Cl |
Computed by PubChem (NCBI)