cas: 143708-33-2 — see every product listed under this CAS number, including other names
2-(Chloromethyl)-6-methylbenzo[d]oxazole 95% (CAS 143708-33-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A510726-100mg |
| cas | 143708-33-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 515.00 Pln | |
| Ambeed | 250mg | 620.69 Pln | |
| Ambeed | 1g | 1171.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A510726 |
2-(chloromethyl)-6-methyl-1,3-benzoxazole (CAS 143708-33-2) is a chemical compound with the molecular formula C9H8ClNO and a molecular weight of 181.62 g/mol. IUPAC name: 2-(chloromethyl)-6-methyl-1,3-benzoxazole. InChIKey: XHGXJTDZCATPBF-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | 2-(chloromethyl)-6-methyl-1,3-benzoxazole |
| InChIKey | XHGXJTDZCATPBF-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(O2)CCl |
Computed by PubChem (NCBI)