cas: 63878-71-7 — see every product listed under this CAS number, including other names
2-(Difluoromethyl)-1-fluoro-4-nitrobenzene, 97%, 97% (CAS 63878-71-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12C1F0-100mg |
| cas | 63878-71-7 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 558.80 Pln | |
| Chemat | 10g | 909.20 Pln | |
| Chemat | 25g | 1816.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(difluoromethyl)-1-fluoro-4-nitrobenzene (CAS 63878-71-7) is a chemical compound with the molecular formula C7H4F3NO2 and a molecular weight of 191.11 g/mol. IUPAC name: 2-(difluoromethyl)-1-fluoro-4-nitrobenzene. InChIKey: VXIMQWWMIPNFEO-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO2 |
|---|---|
| Molecular weight | 191.11 g/mol |
| IUPAC name | 2-(difluoromethyl)-1-fluoro-4-nitrobenzene |
| InChIKey | VXIMQWWMIPNFEO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C(F)F)F |
Computed by PubChem (NCBI)