cas: 441800-93-7 — see every product listed under this CAS number, including other names
2-(Ethoxycarbonyl)-1H-indole-3-carboxylic acid 97% (CAS 441800-93-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A100904-100mg |
| cas | 441800-93-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 531.69 Pln | |
| Ambeed | 250mg | 754.19 Pln | |
| Ambeed | 1g | 1900.06 Pln | |
| Ambeed | 5g | 6483.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A100904 |
2-ethoxycarbonyl-1H-indole-3-carboxylic acid (CAS 441800-93-7) is a chemical compound with the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. IUPAC name: 2-ethoxycarbonyl-1H-indole-3-carboxylic acid. InChIKey: HFKAHXLZJKJMKW-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 2-ethoxycarbonyl-1H-indole-3-carboxylic acid |
| InChIKey | HFKAHXLZJKJMKW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=CC=CC=C2N1)C(=O)O |
Computed by PubChem (NCBI)