Products 86213-20-9
CAS 86213-20-9 appears in our catalog under these names: Alpha-cyano-3,4-dimethoxycinnamic acid, 95%, 2-cyano-3-(3,4-dimethoxyphenyl)acrylic acid. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 1g, 10g, 250mg, 5g, 100mg, on request.
2-cyano-3-(3,4-dimethoxyphenyl)prop-2-enoic acid (CAS 86213-20-9) is a chemical compound with the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. IUPAC name: 2-cyano-3-(3,4-dimethoxyphenyl)prop-2-enoic acid. InChIKey: DMACYVMZKYRYSL-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 2-cyano-3-(3,4-dimethoxyphenyl)prop-2-enoic acid |
| InChIKey | DMACYVMZKYRYSL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C=C(C#N)C(=O)O)OC |
Computed by PubChem (NCBI)