cas: 1228690-72-9 — see every product listed under this CAS number, including other names
2-(Ethoxycarbonylmethyl)phenylboronic acid, pinacol ester, 98%, 98% (CAS 1228690-72-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110GDM-50mg |
| cas | 1228690-72-9 |
| size | 50mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 1154.00 Pln | |
| Chemat | 100mg | 1917.20 Pln | |
| Chemat | 250mg | 3213.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate (CAS 1228690-72-9) is a chemical compound with the molecular formula C16H23BO4 and a molecular weight of 290.2 g/mol. IUPAC name: ethyl 2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate. InChIKey: HPGZZDGRCJGYFU-UHFFFAOYSA-N.
| Molecular formula | C16H23BO4 |
|---|---|
| Molecular weight | 290.2 g/mol |
| IUPAC name | ethyl 2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate |
| InChIKey | HPGZZDGRCJGYFU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2CC(=O)OCC |
Computed by PubChem (NCBI)