cas: 1052138-94-9 — see every product listed under this CAS number, including other names
2-(Methylsulfonyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 98%, 98% (CAS 1052138-94-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11063H-100mg |
| cas | 1052138-94-9 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 1g | 496.40 Pln | |
| Chemat | 5g | 2186.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-methylsulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1052138-94-9) is a chemical compound with the molecular formula C12H18BNO4S and a molecular weight of 283.16 g/mol. IUPAC name: 2-methylsulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: SCUZUURDIKSGEK-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO4S |
|---|---|
| Molecular weight | 283.16 g/mol |
| IUPAC name | 2-methylsulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | SCUZUURDIKSGEK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)S(=O)(=O)C |
Computed by PubChem (NCBI)