Products 1449132-58-4
CAS 1449132-58-4 appears in our catalog under these names: 3-[(3-Methyl-1-piperidinyl)sulfonyl]benzeneboronic acid, 95%, (3-((3-Methylpiperidin-1-yl)sulfonyl)phenyl)boronic acid, 98%, (3–((3–Methylpiperidin–1–yl)sulfonyl)phenyl)boronic acid, (3-((3-Methylpiperidin-1-yl)sulfonyl)phenyl)boronic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 100mg.
[3-(3-methylpiperidin-1-yl)sulfonylphenyl]boronic acid (CAS 1449132-58-4) is a chemical compound with the molecular formula C12H18BNO4S and a molecular weight of 283.16 g/mol. IUPAC name: [3-(3-methylpiperidin-1-yl)sulfonylphenyl]boronic acid. InChIKey: DLRNDOINJINCLN-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO4S |
|---|---|
| Molecular weight | 283.16 g/mol |
| IUPAC name | [3-(3-methylpiperidin-1-yl)sulfonylphenyl]boronic acid |
| InChIKey | DLRNDOINJINCLN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)S(=O)(=O)N2CCCC(C2)C)(O)O |
Computed by PubChem (NCBI)