CAS 71221-26-6 is the registry number for 2-(Naphthalen-2-yl)aniline, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
2-naphthalen-2-ylaniline (CAS 71221-26-6) is a chemical compound with the molecular formula C16H13N and a molecular weight of 219.28 g/mol. IUPAC name: 2-naphthalen-2-ylaniline. InChIKey: LHFDZIZVQQOQPR-UHFFFAOYSA-N.
| Molecular formula | C16H13N |
|---|---|
| Molecular weight | 219.28 g/mol |
| IUPAC name | 2-naphthalen-2-ylaniline |
| InChIKey | LHFDZIZVQQOQPR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=CC=CC=C3N |
Computed by PubChem (NCBI)