CAS 191592-57-1 appears in our catalog under these names: Imidafenacin Related Compound 7, Imidafenacin Impurity 11, Imidafenacin Impurity 9. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2,2-diphenylbut-3-enenitrile (CAS 191592-57-1) is a chemical compound with the molecular formula C16H13N and a molecular weight of 219.28 g/mol. IUPAC name: 2,2-diphenylbut-3-enenitrile. InChIKey: RFVQOMZOVYJFRC-UHFFFAOYSA-N.
| Molecular formula | C16H13N |
|---|---|
| Molecular weight | 219.28 g/mol |
| IUPAC name | 2,2-diphenylbut-3-enenitrile |
| InChIKey | RFVQOMZOVYJFRC-UHFFFAOYSA-N |
| SMILES | C=CC(C#N)(C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)