CAS 838-40-4 appears in our catalog under these names: 2,5-Diphenyl-1H-pyrrole, 95%, 2,5-Diphenyl-1H-pyrrole, 95+%, 2,5-Diphenylpyrrole. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 5g, 1g, 100mg, 500mg, 1000mg, 2000mg.
2,5-diphenyl-1H-pyrrole (CAS 838-40-4) is a chemical compound with the molecular formula C16H13N and a molecular weight of 219.28 g/mol. IUPAC name: 2,5-diphenyl-1H-pyrrole. InChIKey: RJCRXUOYULQDPG-UHFFFAOYSA-N.
| Molecular formula | C16H13N |
|---|---|
| Molecular weight | 219.28 g/mol |
| IUPAC name | 2,5-diphenyl-1H-pyrrole |
| InChIKey | RJCRXUOYULQDPG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)