CAS 71221-26-6 appears in our catalog under these names: 2-(Naphthalen-2-yl)aniline, 95-<97%, 2-(Naphthalen-2-yl)aniline 95+%. Offered by: Hoffman Fine Chemicals, Ambeed. Available pack sizes: 5g, 10g, 25g, 50mg, 100mg, 250mg.
2-naphthalen-2-ylaniline (CAS 71221-26-6) is a chemical compound with the molecular formula C16H13N and a molecular weight of 219.28 g/mol. IUPAC name: 2-naphthalen-2-ylaniline. InChIKey: LHFDZIZVQQOQPR-UHFFFAOYSA-N.
| Molecular formula | C16H13N |
|---|---|
| Molecular weight | 219.28 g/mol |
| IUPAC name | 2-naphthalen-2-ylaniline |
| InChIKey | LHFDZIZVQQOQPR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=CC=CC=C3N |
Computed by PubChem (NCBI)