CAS 26093-30-1 is the registry number for 2,3-Diphenyl-1H-pyrrole, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2,3-diphenyl-1H-pyrrole (CAS 26093-30-1) is a chemical compound with the molecular formula C16H13N and a molecular weight of 219.28 g/mol. IUPAC name: 2,3-diphenyl-1H-pyrrole. InChIKey: VNMNSTIGSQBDPI-UHFFFAOYSA-N.
| Molecular formula | C16H13N |
|---|---|
| Molecular weight | 219.28 g/mol |
| IUPAC name | 2,3-diphenyl-1H-pyrrole |
| InChIKey | VNMNSTIGSQBDPI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(NC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)