cas: 50998-74-8 — see every product listed under this CAS number, including other names
2-(TOLUENE-4-SULFONYLAMINO)-BENZOIC ACID METHYL ESTER, 98%, 98% (CAS 50998-74-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DFML-1g |
| cas | 50998-74-8 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2378.00 Pln | |
| Chemat | 5g | 10475.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-[(4-methylphenyl)sulfonylamino]benzoate (CAS 50998-74-8) is a chemical compound with the molecular formula C15H15NO4S and a molecular weight of 305.4 g/mol. IUPAC name: methyl 2-[(4-methylphenyl)sulfonylamino]benzoate. InChIKey: PNBYWOIWUKQGPR-UHFFFAOYSA-N.
| Molecular formula | C15H15NO4S |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | methyl 2-[(4-methylphenyl)sulfonylamino]benzoate |
| InChIKey | PNBYWOIWUKQGPR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC=C2C(=O)OC |
Computed by PubChem (NCBI)