CAS 727704-68-9 appears in our catalog under these names: 3-([(2,5-Dimethylphenyl)sulfonyl]amino)benzoic acid, 95%, 3-{[(2,5-dimethylphenyl)sulfonyl]amino}benzoic acid, 96%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg.
3-[(2,5-dimethylphenyl)sulfonylamino]benzoic acid (CAS 727704-68-9) is a chemical compound with the molecular formula C15H15NO4S and a molecular weight of 305.4 g/mol. IUPAC name: 3-[(2,5-dimethylphenyl)sulfonylamino]benzoic acid. InChIKey: GFOVIYGXYVCJAZ-UHFFFAOYSA-N.
| Molecular formula | C15H15NO4S |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | 3-[(2,5-dimethylphenyl)sulfonylamino]benzoic acid |
| InChIKey | GFOVIYGXYVCJAZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)S(=O)(=O)NC2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)