Products 327072-13-9

CAS 327072-13-9 is the registry number for 2-(2,5-Dimethyl-benzenesulfonylamino)-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-[(2,5-dimethylphenyl)sulfonylamino]benzoic acid (CAS 327072-13-9) is a chemical compound with the molecular formula C15H15NO4S and a molecular weight of 305.4 g/mol. IUPAC name: 2-[(2,5-dimethylphenyl)sulfonylamino]benzoic acid. InChIKey: KPTXLBXBGAOYCO-UHFFFAOYSA-N.

Identity
Molecular formulaC15H15NO4S
Molecular weight305.4 g/mol
IUPAC name2-[(2,5-dimethylphenyl)sulfonylamino]benzoic acid
InChIKeyKPTXLBXBGAOYCO-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)C)S(=O)(=O)NC2=CC=CC=C2C(=O)O

Computed by PubChem (NCBI)