CAS 327072-13-9 is the registry number for 2-(2,5-Dimethyl-benzenesulfonylamino)-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-[(2,5-dimethylphenyl)sulfonylamino]benzoic acid (CAS 327072-13-9) is a chemical compound with the molecular formula C15H15NO4S and a molecular weight of 305.4 g/mol. IUPAC name: 2-[(2,5-dimethylphenyl)sulfonylamino]benzoic acid. InChIKey: KPTXLBXBGAOYCO-UHFFFAOYSA-N.
| Molecular formula | C15H15NO4S |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | 2-[(2,5-dimethylphenyl)sulfonylamino]benzoic acid |
| InChIKey | KPTXLBXBGAOYCO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)S(=O)(=O)NC2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)