Products 380437-36-5
CAS 380437-36-5 appears in our catalog under these names: 4-(3,4-Dimethyl-phenylsulfamoyl)-benzoic acid, 95%, 4-((3,4-Dimethylphenyl)sulfamoyl)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g.
4-[(3,4-dimethylphenyl)sulfamoyl]benzoic acid (CAS 380437-36-5) is a chemical compound with the molecular formula C15H15NO4S and a molecular weight of 305.4 g/mol. IUPAC name: 4-[(3,4-dimethylphenyl)sulfamoyl]benzoic acid. InChIKey: CAAKJBUSPCRHCS-UHFFFAOYSA-N.
| Molecular formula | C15H15NO4S |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | 4-[(3,4-dimethylphenyl)sulfamoyl]benzoic acid |
| InChIKey | CAAKJBUSPCRHCS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NS(=O)(=O)C2=CC=C(C=C2)C(=O)O)C |
Computed by PubChem (NCBI)
Synonyms:
4-[(3,4-dimethylphenyl)sulfamoyl]benzoic Acid, 4-[[(3,4-Dimethylphenyl)amino]sulfonyl]benzoic acid, 4-((3,4-Dimethylphenyl)sulfamoyl)benzoic acid, 4-(((3,4-Dimethylphenyl)amino)sulfonyl)benzoic acid, 4-(3,4-Dimethyl-phenylsulfamoyl)-benzoic acid, Oprea1_246413, 4-[(3,4-dimethylphenyl)sulfamoyl]benzoicAcid