CAS 554407-31-7 appears in our catalog under these names: 4-(3,4-Dimethyl-benzenesulfonylamino)-benzoic acid, 95%, 4-(3,4-Dimethylbenzenesulfonamido)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
4-[(3,4-dimethylphenyl)sulfonylamino]benzoic acid (CAS 554407-31-7) is a chemical compound with the molecular formula C15H15NO4S and a molecular weight of 305.4 g/mol. IUPAC name: 4-[(3,4-dimethylphenyl)sulfonylamino]benzoic acid. InChIKey: UDOLHJCSMMGKDG-UHFFFAOYSA-N.
| Molecular formula | C15H15NO4S |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | 4-[(3,4-dimethylphenyl)sulfonylamino]benzoic acid |
| InChIKey | UDOLHJCSMMGKDG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)NC2=CC=C(C=C2)C(=O)O)C |
Computed by PubChem (NCBI)