cas: 910036-98-5 — see every product listed under this CAS number, including other names
2-(Tetrahydro-2H-pyran-4-yloxy)pyridine-5-boronic acid, pinacol ester, 95%, 95% (CAS 910036-98-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117RVV-100mg |
| cas | 910036-98-5 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 227.60 Pln | |
| Chemat | 1g | 395.60 Pln | |
| Chemat | 5g | 1240.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(oxan-4-yloxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 910036-98-5) is a chemical compound with the molecular formula C16H24BNO4 and a molecular weight of 305.2 g/mol. IUPAC name: 2-(oxan-4-yloxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: KGCJDMWHIVJQGF-UHFFFAOYSA-N.
| Molecular formula | C16H24BNO4 |
|---|---|
| Molecular weight | 305.2 g/mol |
| IUPAC name | 2-(oxan-4-yloxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | KGCJDMWHIVJQGF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)OC3CCOCC3 |
Computed by PubChem (NCBI)