Products 1704073-41-5
CAS 1704073-41-5 is the registry number for (4–(1–((tert–Butoxycarbonyl)(cyclopropyl)amino)ethyl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 1g.
[4-[1-[cyclopropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl]boronic acid (CAS 1704073-41-5) is a chemical compound with the molecular formula C16H24BNO4 and a molecular weight of 305.2 g/mol. IUPAC name: [4-[1-[cyclopropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl]boronic acid. InChIKey: ATPOSDMGDPGCPN-UHFFFAOYSA-N.
| Molecular formula | C16H24BNO4 |
|---|---|
| Molecular weight | 305.2 g/mol |
| IUPAC name | [4-[1-[cyclopropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl]boronic acid |
| InChIKey | ATPOSDMGDPGCPN-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(C)N(C2CC2)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)