CAS 2096330-03-7 is the registry number for 2-(Dimethylaminomethyl)-4-carboxyphenylboronic acid pinacol ester, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
3-[(dimethylamino)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 2096330-03-7) is a chemical compound with the molecular formula C16H24BNO4 and a molecular weight of 305.2 g/mol. IUPAC name: 3-[(dimethylamino)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: ZNLJZIXCVRSACN-UHFFFAOYSA-N.
| Molecular formula | C16H24BNO4 |
|---|---|
| Molecular weight | 305.2 g/mol |
| IUPAC name | 3-[(dimethylamino)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | ZNLJZIXCVRSACN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C(=O)O)CN(C)C |
Computed by PubChem (NCBI)