Products 2225151-95-9
CAS 2225151-95-9 is the registry number for (4–(1–((TERT–BUTOXY)CARBONYL)PIPERIDIN–3–YL)PHENYL)BORONIC ACID. Offered by: GLPBio. Available pack sizes: 25mg.
[4-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]phenyl]boronic acid (CAS 2225151-95-9) is a chemical compound with the molecular formula C16H24BNO4 and a molecular weight of 305.2 g/mol. IUPAC name: [4-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]phenyl]boronic acid. InChIKey: QPZMVSQIRXEAAP-UHFFFAOYSA-N.
| Molecular formula | C16H24BNO4 |
|---|---|
| Molecular weight | 305.2 g/mol |
| IUPAC name | [4-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]phenyl]boronic acid |
| InChIKey | QPZMVSQIRXEAAP-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2CCCN(C2)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)