CAS 1443110-29-9 is the registry number for N-Ethyl-3-methoxy-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-ethyl-3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 1443110-29-9) is a chemical compound with the molecular formula C16H24BNO4 and a molecular weight of 305.2 g/mol. IUPAC name: N-ethyl-3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: HQEDXNVCMKPEPD-UHFFFAOYSA-N.
| Molecular formula | C16H24BNO4 |
|---|---|
| Molecular weight | 305.2 g/mol |
| IUPAC name | N-ethyl-3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | HQEDXNVCMKPEPD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C(=O)NCC)OC |
Computed by PubChem (NCBI)